C22H23N3O4S — CID 42950298
N-[3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-ylidene]amino]phenyl]acetamide (PubChem CID 42950298) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-ylidene]amino]phenyl]acetamide.
| Compound Name | N-[3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-ylidene]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 42950298 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-methoxyethyl)-1,3-thiazol-2-ylidene]amino]phenyl]acetamide |
| SMILES | COCCn1c(-c2ccc3c(c2)OCCO3)cs/c1=N\c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C22H23N3O4S/c1-15(26)23-17-4-3-5-18(13-17)24-22-25(8-9-27-2)19(14-30-22)16-6-7-20-21(12-16)29-11-10-28-20/h3-7,12-14H,8-11H2,1-2H3,(H,23,26)/b24-22- |
| InChIKey | ZANKXGZJTGRVKU-GYHWCHFESA-N |
| XLogP | 3.83 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|