C12H13FNO3PS — CID 42950565
[[(4-fluorophenyl)methylamino]-thiophen-3-ylmethyl]phosphonic acid (PubChem CID 42950565) has the molecular formula C12H13FNO3PS and a molecular weight of 301.28 g/mol. Its IUPAC name is [[(4-fluorophenyl)methylamino]-thiophen-3-ylmethyl]phosphonic acid.
| Compound Name | [[(4-fluorophenyl)methylamino]-thiophen-3-ylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 42950565 |
| Molecular Formula | C12H13FNO3PS |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | [[(4-fluorophenyl)methylamino]-thiophen-3-ylmethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(NCc1ccc(F)cc1)c1ccsc1 |
| InChI | InChI=1S/C12H13FNO3PS/c13-11-3-1-9(2-4-11)7-14-12(18(15,16)17)10-5-6-19-8-10/h1-6,8,12,14H,7H2,(H2,15,16,17) |
| InChIKey | LWBHGUAQXRQCCN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|