About 2-chloro-1,4-dipentoxybenzene
2-chloro-1,4-dipentoxybenzene (PubChem CID 4295065) has the molecular formula C16H25ClO2
and a molecular weight of 284.83 g/mol. Its IUPAC name is 2-chloro-1,4-dipentoxybenzene.
Molecular Properties
| Compound Name | 2-chloro-1,4-dipentoxybenzene |
| PubChem CID | 4295065 |
| Molecular Formula | C16H25ClO2 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-chloro-1,4-dipentoxybenzene |
| SMILES | CCCCCOc1ccc(OCCCCC)c(Cl)c1 |
| InChI | InChI=1S/C16H25ClO2/c1-3-5-7-11-18-14-9-10-16(15(17)13-14)19-12-8-6-4-2/h9-10,13H,3-8,11-12H2,1-2H3 |
| InChIKey | AFAQYNZHIWKNKO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,4-dipentoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,4-dipentoxybenzene?
The IUPAC name of 2-chloro-1,4-dipentoxybenzene (CID 4295065) is 2-chloro-1,4-dipentoxybenzene.
What is the SMILES notation for 2-chloro-1,4-dipentoxybenzene?
The canonical SMILES for 2-chloro-1,4-dipentoxybenzene is CCCCCOc1ccc(OCCCCC)c(Cl)c1.
What is the InChIKey of 2-chloro-1,4-dipentoxybenzene?
The InChIKey is AFAQYNZHIWKNKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25ClO2/c1-3-5-7-11-18-14-9-10-16(15(17)13-14)19-12-8-6-4-2/h9-10,13H,3-8,11-12H2,1-2H3.
What are the key properties of 2-chloro-1,4-dipentoxybenzene?
2-chloro-1,4-dipentoxybenzene has a molecular weight of 284.83 g/mol, XLogP of 5.48, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,4-dipentoxybenzene is sourced from PubChem (CID 4295065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).