C19H16BrF3N2O2 — CID 42950684
N-(4-bromophenyl)-1-[3-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 42950684) has the molecular formula C19H16BrF3N2O2 and a molecular weight of 441.25 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-[3-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(4-bromophenyl)-1-[3-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 42950684 |
| Molecular Formula | C19H16BrF3N2O2 |
| Molecular Weight | 441.25 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | N-(4-bromophenyl)-1-[3-(trifluoromethyl)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)C1CCCN1C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16BrF3N2O2/c20-14-6-8-15(9-7-14)24-17(26)16-5-2-10-25(16)18(27)12-3-1-4-13(11-12)19(21,22)23/h1,3-4,6-9,11,16H,2,5,10H2,(H,24,26) |
| InChIKey | MNDQXSNPVCTNTR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.25 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |