C23H27N3O4S2 — CID 42951292
N-ethyl-6-[methyl-[1-(4-methylsulfonylphenyl)ethyl]amino]-N-phenylpyridine-3-sulfonamide (PubChem CID 42951292) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-ethyl-6-[methyl-[1-(4-methylsulfonylphenyl)ethyl]amino]-N-phenylpyridine-3-sulfonamide.
| Compound Name | N-ethyl-6-[methyl-[1-(4-methylsulfonylphenyl)ethyl]amino]-N-phenylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 42951292 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-ethyl-6-[methyl-[1-(4-methylsulfonylphenyl)ethyl]amino]-N-phenylpyridine-3-sulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(N(C)C(C)c2ccc(S(C)(=O)=O)cc2)nc1 |
| InChI | InChI=1S/C23H27N3O4S2/c1-5-26(20-9-7-6-8-10-20)32(29,30)22-15-16-23(24-17-22)25(3)18(2)19-11-13-21(14-12-19)31(4,27)28/h6-18H,5H2,1-4H3 |
| InChIKey | HRVZXMWZGXYLPO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |