C20H23ClN2O2S — CID 42951798
N-[1-(4-chlorophenyl)ethyl]-N-methyl-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 42951798) has the molecular formula C20H23ClN2O2S and a molecular weight of 390.94 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-N-methyl-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-N-methyl-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42951798 |
| Molecular Formula | C20H23ClN2O2S |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-N-methyl-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | CC(c1ccc(Cl)cc1)N(C)C(=O)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H23ClN2O2S/c1-14(15-5-7-17(21)8-6-15)22(2)19(24)16-9-11-23(12-10-16)20(25)18-4-3-13-26-18/h3-8,13-14,16H,9-12H2,1-2H3 |
| InChIKey | JKQCNOSZUGMUIK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |