C17H15BrN2O3 — CID 42952948
1-(3-bromophenyl)-N-(2-hydroxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 42952948) has the molecular formula C17H15BrN2O3 and a molecular weight of 375.22 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-(2-hydroxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-(2-hydroxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42952948 |
| Molecular Formula | C17H15BrN2O3 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 1-(3-bromophenyl)-N-(2-hydroxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1O)C1CC(=O)N(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C17H15BrN2O3/c18-12-4-3-5-13(9-12)20-10-11(8-16(20)22)17(23)19-14-6-1-2-7-15(14)21/h1-7,9,11,21H,8,10H2,(H,19,23) |
| InChIKey | XLIANTXRNZCWQP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|