About (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride
(3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride (PubChem CID 42954057) has the molecular formula C9H14ClN3O2
and a molecular weight of 231.68 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride.
Molecular Properties
| Compound Name | (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride |
| PubChem CID | 42954057 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride |
| SMILES | Cc1cc(C(=O)N2CCNCC2)on1.Cl |
| InChI | InChI=1S/C9H13N3O2.ClH/c1-7-6-8(14-11-7)9(13)12-4-2-10-3-5-12;/h6,10H,2-5H2,1H3;1H |
| InChIKey | AFWOMKNWWUBRDZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride?
The IUPAC name of (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride (CID 42954057) is (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride.
What is the SMILES notation for (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride?
The canonical SMILES for (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride is Cc1cc(C(=O)N2CCNCC2)on1.Cl.
What is the InChIKey of (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride?
The InChIKey is AFWOMKNWWUBRDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2.ClH/c1-7-6-8(14-11-7)9(13)12-4-2-10-3-5-12;/h6,10H,2-5H2,1H3;1H.
What are the key properties of (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride?
(3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride has a molecular weight of 231.68 g/mol, XLogP of 0.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,2-oxazol-5-yl)-piperazin-1-ylmethanone;hydrochloride is sourced from PubChem (CID 42954057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).