C18H19FN6O3S3 — CID 42954105
5-[[5-(1,1-dioxothiolan-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-[(4-fluorophenyl)methyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 42954105) has the molecular formula C18H19FN6O3S3 and a molecular weight of 482.59 g/mol. Its IUPAC name is 5-[[5-(1,1-dioxothiolan-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-[(4-fluorophenyl)methyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[[5-(1,1-dioxothiolan-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-[(4-fluorophenyl)methyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 42954105 |
| Molecular Formula | C18H19FN6O3S3 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 5-[[5-(1,1-dioxothiolan-3-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-[(4-fluorophenyl)methyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Cn1c(SCc2nnc(C(=O)NCc3ccc(F)cc3)s2)nnc1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H19FN6O3S3/c1-25-15(12-6-7-31(27,28)10-12)22-24-18(25)29-9-14-21-23-17(30-14)16(26)20-8-11-2-4-13(19)5-3-11/h2-5,12H,6-10H2,1H3,(H,20,26) |
| InChIKey | NUULEHXHIWQOKF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |