C18H24N6O4 — CID 42954841
2-[4-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)-1,4-diazepan-1-yl]-N-propan-2-ylacetamide (PubChem CID 42954841) has the molecular formula C18H24N6O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[4-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)-1,4-diazepan-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)-1,4-diazepan-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 42954841 |
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-[4-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)-1,4-diazepan-1-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1CCCN(c2nc3ccccn3c(=O)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H24N6O4/c1-13(2)19-15(25)12-21-7-5-8-22(11-10-21)17-16(24(27)28)18(26)23-9-4-3-6-14(23)20-17/h3-4,6,9,13H,5,7-8,10-12H2,1-2H3,(H,19,25) |
| InChIKey | KYBQGSUSPWDLQZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|