About 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide
2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide (PubChem CID 42954992) has the molecular formula C13H27N3O2
and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide.
Molecular Properties
| Compound Name | 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide |
| PubChem CID | 42954992 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide |
| SMILES | CC(C)NC(=O)NC(=O)CN(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C13H27N3O2/c1-9(2)14-12(18)15-11(17)8-16(7)10(3)13(4,5)6/h9-10H,8H2,1-7H3,(H2,14,15,17,18) |
| InChIKey | AVZCVFWHUXCWBR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide?
The IUPAC name of 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide (CID 42954992) is 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide.
What is the SMILES notation for 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide?
The canonical SMILES for 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide is CC(C)NC(=O)NC(=O)CN(C)C(C)C(C)(C)C.
What is the InChIKey of 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide?
The InChIKey is AVZCVFWHUXCWBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2/c1-9(2)14-12(18)15-11(17)8-16(7)10(3)13(4,5)6/h9-10H,8H2,1-7H3,(H2,14,15,17,18).
What are the key properties of 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide?
2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide has a molecular weight of 257.38 g/mol, XLogP of 1.59, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,3-dimethylbutan-2-yl(methyl)amino]-N-(propan-2-ylcarbamoyl)acetamide is sourced from PubChem (CID 42954992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).