C18H16ClN3O3 — CID 42955330
1-[3-(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)-5-cyclopropyl-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 42955330) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is 1-[3-(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)-5-cyclopropyl-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 1-[3-(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)-5-cyclopropyl-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 42955330 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-[3-(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)-5-cyclopropyl-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | CC(=O)N1N=C(C2CC2)CC1c1cc2cc3c(cc2nc1Cl)OCO3 |
| InChI | InChI=1S/C18H16ClN3O3/c1-9(23)22-15(6-14(21-22)10-2-3-10)12-4-11-5-16-17(25-8-24-16)7-13(11)20-18(12)19/h4-5,7,10,15H,2-3,6,8H2,1H3 |
| InChIKey | MUGRUFMUBASYED-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|