C20H22N4O2 — CID 42955377
2-[(2,4-dioxo-8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)methyl]pentanedinitrile (PubChem CID 42955377) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[(2,4-dioxo-8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)methyl]pentanedinitrile.
| Compound Name | 2-[(2,4-dioxo-8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)methyl]pentanedinitrile |
|---|---|
| PubChem CID | 42955377 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-[(2,4-dioxo-8-phenyl-1,3-diazaspiro[4.5]decan-3-yl)methyl]pentanedinitrile |
| SMILES | N#CCCC(C#N)CN1C(=O)NC2(CCC(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C20H22N4O2/c21-12-4-5-15(13-22)14-24-18(25)20(23-19(24)26)10-8-17(9-11-20)16-6-2-1-3-7-16/h1-3,6-7,15,17H,4-5,8-11,14H2,(H,23,26) |
| InChIKey | XQSRAGRCGQNBHH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|