About [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate
[3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 4295561) has the molecular formula C21H26FNO4S
and a molecular weight of 407.51 g/mol. Its IUPAC name is [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
Molecular Properties
| Compound Name | [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| PubChem CID | 4295561 |
| Molecular Formula | C21H26FNO4S |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(C)CN(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)C(C)C |
| InChI | InChI=1S/C21H26FNO4S/c1-15(2)13-23(21(24)16(3)4)14-17-6-5-7-19(12-17)27-28(25,26)20-10-8-18(22)9-11-20/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | PHKOUWYNMZBKEF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate?
The IUPAC name of [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (CID 4295561) is [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
What is the SMILES notation for [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate?
The canonical SMILES for [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate is CC(C)CN(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)C(C)C.
What is the InChIKey of [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate?
The InChIKey is PHKOUWYNMZBKEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26FNO4S/c1-15(2)13-23(21(24)16(3)4)14-17-6-5-7-19(12-17)27-28(25,26)20-10-8-18(22)9-11-20/h5-12,15-16H,13-14H2,1-4H3.
What are the key properties of [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate?
[3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate has a molecular weight of 407.51 g/mol, XLogP of 4.23, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate is sourced from PubChem (CID 4295561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).