C26H22N2O4 — CID 42956062
4-[2-hydroxy-3-(7-methoxy-2-oxo-4-phenylquinolin-1-yl)propoxy]benzonitrile (PubChem CID 42956062) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is 4-[2-hydroxy-3-(7-methoxy-2-oxo-4-phenylquinolin-1-yl)propoxy]benzonitrile.
| Compound Name | 4-[2-hydroxy-3-(7-methoxy-2-oxo-4-phenylquinolin-1-yl)propoxy]benzonitrile |
|---|---|
| PubChem CID | 42956062 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 4-[2-hydroxy-3-(7-methoxy-2-oxo-4-phenylquinolin-1-yl)propoxy]benzonitrile |
| SMILES | COc1ccc2c(-c3ccccc3)cc(=O)n(CC(O)COc3ccc(C#N)cc3)c2c1 |
| InChI | InChI=1S/C26H22N2O4/c1-31-22-11-12-23-24(19-5-3-2-4-6-19)14-26(30)28(25(23)13-22)16-20(29)17-32-21-9-7-18(15-27)8-10-21/h2-14,20,29H,16-17H2,1H3 |
| InChIKey | HLQOHMOGNYYMKN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |