C11H13F9N2O2 — CID 4295691
2,2,3,3,4,4,5,5,5-nonafluoro-N-(2-morpholin-4-ylethyl)pentanamide (PubChem CID 4295691) has the molecular formula C11H13F9N2O2 and a molecular weight of 376.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-(2-morpholin-4-ylethyl)pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(2-morpholin-4-ylethyl)pentanamide |
|---|---|
| PubChem CID | 4295691 |
| Molecular Formula | C11H13F9N2O2 |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(2-morpholin-4-ylethyl)pentanamide |
| SMILES | O=C(NCCN1CCOCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F9N2O2/c12-8(13,9(14,15)10(16,17)11(18,19)20)7(23)21-1-2-22-3-5-24-6-4-22/h1-6H2,(H,21,23) |
| InChIKey | OYKPEBLYBJNWIP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|