C14H19N5O2 — CID 42957417
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile (PubChem CID 42957417) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 42957417 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
| SMILES | Cn1c(N2CCN3CCCC3C2)c(C#N)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H19N5O2/c1-16-12(11(8-15)13(20)17(2)14(16)21)19-7-6-18-5-3-4-10(18)9-19/h10H,3-7,9H2,1-2H3 |
| InChIKey | DXVRVHDPYTZWRB-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |