C14H18N4O2 — CID 42957830
2-[(3-cyanophenyl)methyl-methylamino]-N-(methylcarbamoyl)propanamide (PubChem CID 42957830) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[(3-cyanophenyl)methyl-methylamino]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[(3-cyanophenyl)methyl-methylamino]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 42957830 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-[(3-cyanophenyl)methyl-methylamino]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)N(C)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C14H18N4O2/c1-10(13(19)17-14(20)16-2)18(3)9-12-6-4-5-11(7-12)8-15/h4-7,10H,9H2,1-3H3,(H2,16,17,19,20) |
| InChIKey | OGYREGKISUWESN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |