About N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide
N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide (PubChem CID 42958041) has the molecular formula C15H31N3O3S
and a molecular weight of 333.50 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide |
| PubChem CID | 42958041 |
| Molecular Formula | C15H31N3O3S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCN(S(=O)(=O)NCC(C)N2CC(C)OC(C)C2)CC1 |
| InChI | InChI=1S/C15H31N3O3S/c1-12-5-7-18(8-6-12)22(19,20)16-9-13(2)17-10-14(3)21-15(4)11-17/h12-16H,5-11H2,1-4H3 |
| InChIKey | ZMQFALDTVDTWFI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide?
The IUPAC name of N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide (CID 42958041) is N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide.
What is the SMILES notation for N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide?
The canonical SMILES for N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide is CC1CCN(S(=O)(=O)NCC(C)N2CC(C)OC(C)C2)CC1.
What is the InChIKey of N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide?
The InChIKey is ZMQFALDTVDTWFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3O3S/c1-12-5-7-18(8-6-12)22(19,20)16-9-13(2)17-10-14(3)21-15(4)11-17/h12-16H,5-11H2,1-4H3.
What are the key properties of N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide?
N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide has a molecular weight of 333.50 g/mol, XLogP of 1.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-4-methylpiperidine-1-sulfonamide is sourced from PubChem (CID 42958041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).