About N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide
N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide (PubChem CID 42958243) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide |
| PubChem CID | 42958243 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide |
| SMILES | O=C(NC1CC2CC1C1CCCC21)C1CCCC1 |
| InChI | InChI=1S/C16H25NO/c18-16(10-4-1-2-5-10)17-15-9-11-8-14(15)13-7-3-6-12(11)13/h10-15H,1-9H2,(H,17,18) |
| InChIKey | BZXOABZMDMMILA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide?
The IUPAC name of N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide (CID 42958243) is N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide.
What is the SMILES notation for N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide?
The canonical SMILES for N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide is O=C(NC1CC2CC1C1CCCC21)C1CCCC1.
What is the InChIKey of N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide?
The InChIKey is BZXOABZMDMMILA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO/c18-16(10-4-1-2-5-10)17-15-9-11-8-14(15)13-7-3-6-12(11)13/h10-15H,1-9H2,(H,17,18).
What are the key properties of N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide?
N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide has a molecular weight of 247.38 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8-tricyclo[5.2.1.02,6]decanyl)cyclopentanecarboxamide is sourced from PubChem (CID 42958243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).