About 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide
3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide (PubChem CID 42958251) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide.
Molecular Properties
| Compound Name | 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide |
| PubChem CID | 42958251 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide |
| SMILES | CC(C)=CC(=O)NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C15H23NO/c1-9(2)6-15(17)16-14-8-10-7-13(14)12-5-3-4-11(10)12/h6,10-14H,3-5,7-8H2,1-2H3,(H,16,17) |
| InChIKey | CXYGHHKYZADZHP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide?
The IUPAC name of 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide (CID 42958251) is 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide.
What is the SMILES notation for 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide?
The canonical SMILES for 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide is CC(C)=CC(=O)NC1CC2CC1C1CCCC21.
What is the InChIKey of 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide?
The InChIKey is CXYGHHKYZADZHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-9(2)6-15(17)16-14-8-10-7-13(14)12-5-3-4-11(10)12/h6,10-14H,3-5,7-8H2,1-2H3,(H,16,17).
What are the key properties of 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide?
3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide has a molecular weight of 233.35 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)but-2-enamide is sourced from PubChem (CID 42958251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).