About pyrazolidine-3,5-dione
pyrazolidine-3,5-dione (PubChem CID 4295838) has the molecular formula C3H4N2O2
and a molecular weight of 100.08 g/mol. Its IUPAC name is pyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | pyrazolidine-3,5-dione |
| PubChem CID | 4295838 |
| Molecular Formula | C3H4N2O2 |
| Molecular Weight | 100.08 g/mol |
| Exact Mass | 100.03 |
| IUPAC Name | pyrazolidine-3,5-dione |
| SMILES | O=C1CC(=O)NN1 |
| InChI | InChI=1S/C3H4N2O2/c6-2-1-3(7)5-4-2/h1H2,(H,4,6)(H,5,7) |
| InChIKey | DNTVKOMHCDKATN-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.08 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolidine-3,5-dione?
The IUPAC name of pyrazolidine-3,5-dione (CID 4295838) is pyrazolidine-3,5-dione.
What is the SMILES notation for pyrazolidine-3,5-dione?
The canonical SMILES for pyrazolidine-3,5-dione is O=C1CC(=O)NN1.
What is the InChIKey of pyrazolidine-3,5-dione?
The InChIKey is DNTVKOMHCDKATN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2/c6-2-1-3(7)5-4-2/h1H2,(H,4,6)(H,5,7).
What are the key properties of pyrazolidine-3,5-dione?
pyrazolidine-3,5-dione has a molecular weight of 100.08 g/mol, XLogP of -1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolidine-3,5-dione is sourced from PubChem (CID 4295838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).