About 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide
1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 42958510) has the molecular formula C22H33N3O3
and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide |
| PubChem CID | 42958510 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | CC(=O)N1CCCC(C(=O)NCc2ccc(CN3CC(C)OC(C)C3)cc2)C1 |
| InChI | InChI=1S/C22H33N3O3/c1-16-12-24(13-17(2)28-16)14-20-8-6-19(7-9-20)11-23-22(27)21-5-4-10-25(15-21)18(3)26/h6-9,16-17,21H,4-5,10-15H2,1-3H3,(H,23,27) |
| InChIKey | LFHAPCSCADLNOZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide?
The IUPAC name of 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide (CID 42958510) is 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide.
What is the SMILES notation for 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide?
The canonical SMILES for 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide is CC(=O)N1CCCC(C(=O)NCc2ccc(CN3CC(C)OC(C)C3)cc2)C1.
What is the InChIKey of 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide?
The InChIKey is LFHAPCSCADLNOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33N3O3/c1-16-12-24(13-17(2)28-16)14-20-8-6-19(7-9-20)11-23-22(27)21-5-4-10-25(15-21)18(3)26/h6-9,16-17,21H,4-5,10-15H2,1-3H3,(H,23,27).
What are the key properties of 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide?
1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide has a molecular weight of 387.52 g/mol, XLogP of 2.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-N-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methyl]piperidine-3-carboxamide is sourced from PubChem (CID 42958510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).