About 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole
2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole (PubChem CID 42958826) has the molecular formula C14H14F2N2O2S
and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole.
Molecular Properties
| Compound Name | 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole |
| PubChem CID | 42958826 |
| Molecular Formula | C14H14F2N2O2S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole |
| SMILES | O=S(=O)(c1cc(F)cc(F)c1)N1CCCC1c1ccc[nH]1 |
| InChI | InChI=1S/C14H14F2N2O2S/c15-10-7-11(16)9-12(8-10)21(19,20)18-6-2-4-14(18)13-3-1-5-17-13/h1,3,5,7-9,14,17H,2,4,6H2 |
| InChIKey | KOSLEIDDCLJPLT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole?
The IUPAC name of 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole (CID 42958826) is 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole.
What is the SMILES notation for 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole?
The canonical SMILES for 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole is O=S(=O)(c1cc(F)cc(F)c1)N1CCCC1c1ccc[nH]1.
What is the InChIKey of 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole?
The InChIKey is KOSLEIDDCLJPLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N2O2S/c15-10-7-11(16)9-12(8-10)21(19,20)18-6-2-4-14(18)13-3-1-5-17-13/h1,3,5,7-9,14,17H,2,4,6H2.
What are the key properties of 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole?
2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole has a molecular weight of 312.34 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,5-difluorophenyl)sulfonylpyrrolidin-2-yl]-1H-pyrrole is sourced from PubChem (CID 42958826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).