C14H17NO5S — CID 42958960
1-(2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one (PubChem CID 42958960) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one.
| Compound Name | 1-(2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
|---|---|
| PubChem CID | 42958960 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
| SMILES | COc1ccc(N2C(=O)CC3CS(=O)(=O)CC32)c(OC)c1 |
| InChI | InChI=1S/C14H17NO5S/c1-19-10-3-4-11(13(6-10)20-2)15-12-8-21(17,18)7-9(12)5-14(15)16/h3-4,6,9,12H,5,7-8H2,1-2H3 |
| InChIKey | VATWDXNNZQSYIC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |