C15H22ClN3O3 — CID 42959637
ethyl N-[1-[(4-chloropyridine-2-carbonyl)amino]-4-methylpentan-2-yl]carbamate (PubChem CID 42959637) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is ethyl N-[1-[(4-chloropyridine-2-carbonyl)amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[(4-chloropyridine-2-carbonyl)amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 42959637 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | ethyl N-[1-[(4-chloropyridine-2-carbonyl)amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)c1cc(Cl)ccn1)CC(C)C |
| InChI | InChI=1S/C15H22ClN3O3/c1-4-22-15(21)19-12(7-10(2)3)9-18-14(20)13-8-11(16)5-6-17-13/h5-6,8,10,12H,4,7,9H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | PUYKTSGVKNJNFK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |