C18H18N2O — CID 42959795
N-[4-[cyano(phenyl)methyl]phenyl]-2-methylpropanamide (PubChem CID 42959795) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[4-[cyano(phenyl)methyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[cyano(phenyl)methyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 42959795 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-[4-[cyano(phenyl)methyl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(C#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N2O/c1-13(2)18(21)20-16-10-8-15(9-11-16)17(12-19)14-6-4-3-5-7-14/h3-11,13,17H,1-2H3,(H,20,21) |
| InChIKey | JCECARWRZMYCPB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |