C23H19ClN4O6 — CID 4296011
3-chloro-N-[2-[[(3-ethoxy-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-4-nitrobenzamide (PubChem CID 4296011) has the molecular formula C23H19ClN4O6 and a molecular weight of 482.88 g/mol. Its IUPAC name is 3-chloro-N-[2-[[(3-ethoxy-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-4-nitrobenzamide.
| Compound Name | 3-chloro-N-[2-[[(3-ethoxy-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4296011 |
| Molecular Formula | C23H19ClN4O6 |
| Molecular Weight | 482.88 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 3-chloro-N-[2-[[(3-ethoxy-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-4-nitrobenzamide |
| SMILES | CCOc1cc(C=NNC(=O)c2ccccc2NC(=O)c2ccc([N+](=O)[O-])c(Cl)c2)ccc1O |
| InChI | InChI=1S/C23H19ClN4O6/c1-2-34-21-11-14(7-10-20(21)29)13-25-27-23(31)16-5-3-4-6-18(16)26-22(30)15-8-9-19(28(32)33)17(24)12-15/h3-13,29H,2H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | SNOFNZXSBOQJBZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|