C15H18ClN3OS — CID 42960457
7-(3-methyl-2-methylimino-1,3-thiazol-4-yl)-1,3,4,5-tetrahydro-1-benzazepin-2-one;hydrochloride (PubChem CID 42960457) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is 7-(3-methyl-2-methylimino-1,3-thiazol-4-yl)-1,3,4,5-tetrahydro-1-benzazepin-2-one;hydrochloride.
| Compound Name | 7-(3-methyl-2-methylimino-1,3-thiazol-4-yl)-1,3,4,5-tetrahydro-1-benzazepin-2-one;hydrochloride |
|---|---|
| PubChem CID | 42960457 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 7-(3-methyl-2-methylimino-1,3-thiazol-4-yl)-1,3,4,5-tetrahydro-1-benzazepin-2-one;hydrochloride |
| SMILES | C/N=c1\scc(-c2ccc3c(c2)CCCC(=O)N3)n1C.Cl |
| InChI | InChI=1S/C15H17N3OS.ClH/c1-16-15-18(2)13(9-20-15)11-6-7-12-10(8-11)4-3-5-14(19)17-12;/h6-9H,3-5H2,1-2H3,(H,17,19);1H/b16-15-; |
| InChIKey | YQAOMFCJOBATLO-YFKNTREVSA-N |
| XLogP | 2.98 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|