About 5-methyl-2,4-diphenyl-1,3-oxazole
5-methyl-2,4-diphenyl-1,3-oxazole (PubChem CID 4296141) has the molecular formula C16H13NO
and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-methyl-2,4-diphenyl-1,3-oxazole.
Molecular Properties
| Compound Name | 5-methyl-2,4-diphenyl-1,3-oxazole |
| PubChem CID | 4296141 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 5-methyl-2,4-diphenyl-1,3-oxazole |
| SMILES | Cc1oc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C16H13NO/c1-12-15(13-8-4-2-5-9-13)17-16(18-12)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | KUHVAHAVYJKLRN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-2,4-diphenyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,4-diphenyl-1,3-oxazole?
The IUPAC name of 5-methyl-2,4-diphenyl-1,3-oxazole (CID 4296141) is 5-methyl-2,4-diphenyl-1,3-oxazole.
What is the SMILES notation for 5-methyl-2,4-diphenyl-1,3-oxazole?
The canonical SMILES for 5-methyl-2,4-diphenyl-1,3-oxazole is Cc1oc(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of 5-methyl-2,4-diphenyl-1,3-oxazole?
The InChIKey is KUHVAHAVYJKLRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO/c1-12-15(13-8-4-2-5-9-13)17-16(18-12)14-10-6-3-7-11-14/h2-11H,1H3.
What are the key properties of 5-methyl-2,4-diphenyl-1,3-oxazole?
5-methyl-2,4-diphenyl-1,3-oxazole has a molecular weight of 235.29 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,4-diphenyl-1,3-oxazole is sourced from PubChem (CID 4296141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).