About 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole
2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole (PubChem CID 4296144) has the molecular formula C20H13BrFN3S
and a molecular weight of 426.31 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole |
| PubChem CID | 4296144 |
| Molecular Formula | C20H13BrFN3S |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole |
| SMILES | Fc1ccccc1C1C=C(c2ccc(Br)s2)Nc2nc3ccccc3n21 |
| InChI | InChI=1S/C20H13BrFN3S/c21-19-10-9-18(26-19)15-11-17(12-5-1-2-6-13(12)22)25-16-8-4-3-7-14(16)23-20(25)24-15/h1-11,17H,(H,23,24) |
| InChIKey | FUCZJCQBCAYIOO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole?
The IUPAC name of 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole (CID 4296144) is 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole.
What is the SMILES notation for 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole?
The canonical SMILES for 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole is Fc1ccccc1C1C=C(c2ccc(Br)s2)Nc2nc3ccccc3n21.
What is the InChIKey of 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole?
The InChIKey is FUCZJCQBCAYIOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13BrFN3S/c21-19-10-9-18(26-19)15-11-17(12-5-1-2-6-13(12)22)25-16-8-4-3-7-14(16)23-20(25)24-15/h1-11,17H,(H,23,24).
What are the key properties of 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole?
2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole has a molecular weight of 426.31 g/mol, XLogP of 6.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromothiophen-2-yl)-4-(2-fluorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole is sourced from PubChem (CID 4296144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).