About 2-bromo-4,5-dimethoxybenzonitrile
2-bromo-4,5-dimethoxybenzonitrile (PubChem CID 4296227) has the molecular formula C9H8BrNO2
and a molecular weight of 242.07 g/mol. Its IUPAC name is 2-bromo-4,5-dimethoxybenzonitrile.
Molecular Properties
| Compound Name | 2-bromo-4,5-dimethoxybenzonitrile |
| PubChem CID | 4296227 |
| Molecular Formula | C9H8BrNO2 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 2-bromo-4,5-dimethoxybenzonitrile |
| SMILES | COc1cc(Br)c(C#N)cc1OC |
| InChI | InChI=1S/C9H8BrNO2/c1-12-8-3-6(5-11)7(10)4-9(8)13-2/h3-4H,1-2H3 |
| InChIKey | BCLBFUAPLHUFET-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-4,5-dimethoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,5-dimethoxybenzonitrile?
The IUPAC name of 2-bromo-4,5-dimethoxybenzonitrile (CID 4296227) is 2-bromo-4,5-dimethoxybenzonitrile.
What is the SMILES notation for 2-bromo-4,5-dimethoxybenzonitrile?
The canonical SMILES for 2-bromo-4,5-dimethoxybenzonitrile is COc1cc(Br)c(C#N)cc1OC.
What is the InChIKey of 2-bromo-4,5-dimethoxybenzonitrile?
The InChIKey is BCLBFUAPLHUFET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO2/c1-12-8-3-6(5-11)7(10)4-9(8)13-2/h3-4H,1-2H3.
What are the key properties of 2-bromo-4,5-dimethoxybenzonitrile?
2-bromo-4,5-dimethoxybenzonitrile has a molecular weight of 242.07 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,5-dimethoxybenzonitrile is sourced from PubChem (CID 4296227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).