About 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide
2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide (PubChem CID 42962651) has the molecular formula C12H15F2NO3S
and a molecular weight of 291.32 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide.
Molecular Properties
| Compound Name | 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide |
| PubChem CID | 42962651 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H15F2NO3S/c1-3-6-15-12(16)8(2)19(17,18)9-4-5-10(13)11(14)7-9/h4-5,7-8H,3,6H2,1-2H3,(H,15,16) |
| InChIKey | FOTXLIVOEGSBMO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide?
The IUPAC name of 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide (CID 42962651) is 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide.
What is the SMILES notation for 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide?
The canonical SMILES for 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide is CCCNC(=O)C(C)S(=O)(=O)c1ccc(F)c(F)c1.
What is the InChIKey of 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide?
The InChIKey is FOTXLIVOEGSBMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2NO3S/c1-3-6-15-12(16)8(2)19(17,18)9-4-5-10(13)11(14)7-9/h4-5,7-8H,3,6H2,1-2H3,(H,15,16).
What are the key properties of 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide?
2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide has a molecular weight of 291.32 g/mol, XLogP of 1.65, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)sulfonyl-N-propylpropanamide is sourced from PubChem (CID 42962651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).