About methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide
methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide (PubChem CID 42962662) has the molecular formula C14H23IN2OS
and a molecular weight of 394.32 g/mol. Its IUPAC name is methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide.
Molecular Properties
| Compound Name | methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide |
| PubChem CID | 42962662 |
| Molecular Formula | C14H23IN2OS |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide |
| SMILES | CS/C(=N\Cc1ccco1)N1CC(C)CC(C)C1.I |
| InChI | InChI=1S/C14H22N2OS.HI/c1-11-7-12(2)10-16(9-11)14(18-3)15-8-13-5-4-6-17-13;/h4-6,11-12H,7-10H2,1-3H3;1H/b15-14-; |
| InChIKey | HLHZDAHVFAQNLB-BGWNKZQTSA-N |
| XLogP | 4.09 |
| TPSA | 28.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide?
The IUPAC name of methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide (CID 42962662) is methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide.
What is the SMILES notation for methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide?
The canonical SMILES for methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide is CS/C(=N\Cc1ccco1)N1CC(C)CC(C)C1.I.
What is the InChIKey of methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide?
The InChIKey is HLHZDAHVFAQNLB-BGWNKZQTSA-N. The full InChI is InChI=1S/C14H22N2OS.HI/c1-11-7-12(2)10-16(9-11)14(18-3)15-8-13-5-4-6-17-13;/h4-6,11-12H,7-10H2,1-3H3;1H/b15-14-;.
What are the key properties of methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide?
methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide has a molecular weight of 394.32 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(furan-2-ylmethyl)-3,5-dimethylpiperidine-1-carboximidothioate;hydroiodide is sourced from PubChem (CID 42962662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).