C16H17N7OS — CID 42962782
2-[2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 42962782) has the molecular formula C16H17N7OS and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-[2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 42962782 |
| Molecular Formula | C16H17N7OS |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | Cc1nc2nc(SCCn3nc4ccccn4c3=O)nn2c(C)c1C |
| InChI | InChI=1S/C16H17N7OS/c1-10-11(2)17-14-18-15(20-23(14)12(10)3)25-9-8-22-16(24)21-7-5-4-6-13(21)19-22/h4-7H,8-9H2,1-3H3 |
| InChIKey | QWXVCIGWLRBYEG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |