C17H13Cl2N3O4 — CID 42964351
3-[(3,4-dichlorophenyl)methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 42964351) has the molecular formula C17H13Cl2N3O4 and a molecular weight of 394.21 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42964351 |
| Molecular Formula | C17H13Cl2N3O4 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc([N+](=O)[O-])cc2)NC(=O)N(Cc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C17H13Cl2N3O4/c1-17(11-3-5-12(6-4-11)22(25)26)15(23)21(16(24)20-17)9-10-2-7-13(18)14(19)8-10/h2-8H,9H2,1H3,(H,20,24) |
| InChIKey | PZSRUOVAJKJVNV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|