C24H28N2O6 — CID 42965226
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate (PubChem CID 42965226) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate |
|---|---|
| PubChem CID | 42965226 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetate |
| SMILES | CC1(C)Cc2cccc(OCC(=O)OCC(=O)Nc3ccc(N4CCOCC4)cc3)c2O1 |
| InChI | InChI=1S/C24H28N2O6/c1-24(2)14-17-4-3-5-20(23(17)32-24)30-16-22(28)31-15-21(27)25-18-6-8-19(9-7-18)26-10-12-29-13-11-26/h3-9H,10-16H2,1-2H3,(H,25,27) |
| InChIKey | WXHJLKOGDYJJAT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|