C20H21NO4 — CID 42967097
[2-(2-methoxy-5-methylanilino)-2-oxoethyl] (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 42967097) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxoethyl] (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 42967097 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | COc1ccc(C)cc1NC(=O)COC(=O)/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-14-4-7-16(8-5-14)9-11-20(23)25-13-19(22)21-17-12-15(2)6-10-18(17)24-3/h4-12H,13H2,1-3H3,(H,21,22)/b11-9+ |
| InChIKey | LALIWXCMAHDPEW-PKNBQFBNSA-N |
| XLogP | 3.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|