C18H17ClINO4 — CID 42969953
[2-(2-iodoanilino)-2-oxoethyl] 2-(4-chloro-2-methylphenoxy)propanoate (PubChem CID 42969953) has the molecular formula C18H17ClINO4 and a molecular weight of 473.69 g/mol. Its IUPAC name is [2-(2-iodoanilino)-2-oxoethyl] 2-(4-chloro-2-methylphenoxy)propanoate.
| Compound Name | [2-(2-iodoanilino)-2-oxoethyl] 2-(4-chloro-2-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 42969953 |
| Molecular Formula | C18H17ClINO4 |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | [2-(2-iodoanilino)-2-oxoethyl] 2-(4-chloro-2-methylphenoxy)propanoate |
| SMILES | Cc1cc(Cl)ccc1OC(C)C(=O)OCC(=O)Nc1ccccc1I |
| InChI | InChI=1S/C18H17ClINO4/c1-11-9-13(19)7-8-16(11)25-12(2)18(23)24-10-17(22)21-15-6-4-3-5-14(15)20/h3-9,12H,10H2,1-2H3,(H,21,22) |
| InChIKey | OWJIPFFXAFYNGG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|