C24H35N3O6 — CID 42970634
[1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate (PubChem CID 42970634) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate.
| Compound Name | [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 42970634 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OC(C)C(=O)NC(=O)NC1CCCCC1)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C24H35N3O6/c1-14(2)13-19(27-21(29)17-11-7-8-12-18(17)22(27)30)23(31)33-15(3)20(28)26-24(32)25-16-9-5-4-6-10-16/h7-8,14-19H,4-6,9-13H2,1-3H3,(H2,25,26,28,32) |
| InChIKey | ZONINRYSABZCQD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|