C12H13N3O2S2 — CID 42971507
methyl 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate (PubChem CID 42971507) has the molecular formula C12H13N3O2S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is methyl 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate.
| Compound Name | methyl 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 42971507 |
| Molecular Formula | C12H13N3O2S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | methyl 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate |
| SMILES | COC(=O)C(C)Sc1nnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C12H13N3O2S2/c1-8(10(16)17-2)18-12-15-14-11(19-12)13-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,13,14) |
| InChIKey | WYJZTWHUQQUBLF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |