C25H31N3O4 — CID 42975832
[1-(3-methoxyanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate (PubChem CID 42975832) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is [1-(3-methoxyanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | [1-(3-methoxyanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 42975832 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | [1-(3-methoxyanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylbutyl)pyrrol-3-yl]prop-2-enoate |
| SMILES | COc1cccc(NC(=O)C(C)OC(=O)/C(C#N)=C/c2cc(C)n(CCC(C)C)c2C)c1 |
| InChI | InChI=1S/C25H31N3O4/c1-16(2)10-11-28-17(3)12-20(18(28)4)13-21(15-26)25(30)32-19(5)24(29)27-22-8-7-9-23(14-22)31-6/h7-9,12-14,16,19H,10-11H2,1-6H3,(H,27,29)/b21-13+ |
| InChIKey | GWIMYGNRFJOQHK-FYJGNVAPSA-N |
| XLogP | 4.64 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|