C21H16N2OS — CID 4298041
2-phenyl-N-(thiophen-2-ylmethyl)quinoline-4-carboxamide (PubChem CID 4298041) has the molecular formula C21H16N2OS and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-phenyl-N-(thiophen-2-ylmethyl)quinoline-4-carboxamide.
| Compound Name | 2-phenyl-N-(thiophen-2-ylmethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4298041 |
| Molecular Formula | C21H16N2OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-phenyl-N-(thiophen-2-ylmethyl)quinoline-4-carboxamide |
| SMILES | O=C(NCc1cccs1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C21H16N2OS/c24-21(22-14-16-9-6-12-25-16)18-13-20(15-7-2-1-3-8-15)23-19-11-5-4-10-17(18)19/h1-13H,14H2,(H,22,24) |
| InChIKey | PAULFNZXLLENNY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |