About cyclohexa-2,4-dien-1-yl(diphenyl)phosphane
cyclohexa-2,4-dien-1-yl(diphenyl)phosphane (PubChem CID 4298218) has the molecular formula C18H17P
and a molecular weight of 264.31 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-yl(diphenyl)phosphane.
Molecular Properties
| Compound Name | cyclohexa-2,4-dien-1-yl(diphenyl)phosphane |
| PubChem CID | 4298218 |
| Molecular Formula | C18H17P |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | cyclohexa-2,4-dien-1-yl(diphenyl)phosphane |
| SMILES | C1=CCC(P(c2ccccc2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C18H17P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-14,18H,15H2 |
| InChIKey | WWAVXKGDVWAIFD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,4-dien-1-yl(diphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,4-dien-1-yl(diphenyl)phosphane?
The IUPAC name of cyclohexa-2,4-dien-1-yl(diphenyl)phosphane (CID 4298218) is cyclohexa-2,4-dien-1-yl(diphenyl)phosphane.
What is the SMILES notation for cyclohexa-2,4-dien-1-yl(diphenyl)phosphane?
The canonical SMILES for cyclohexa-2,4-dien-1-yl(diphenyl)phosphane is C1=CCC(P(c2ccccc2)c2ccccc2)C=C1.
What is the InChIKey of cyclohexa-2,4-dien-1-yl(diphenyl)phosphane?
The InChIKey is WWAVXKGDVWAIFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-14,18H,15H2.
What are the key properties of cyclohexa-2,4-dien-1-yl(diphenyl)phosphane?
cyclohexa-2,4-dien-1-yl(diphenyl)phosphane has a molecular weight of 264.31 g/mol, XLogP of 4.00, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,4-dien-1-yl(diphenyl)phosphane is sourced from PubChem (CID 4298218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).