C20H15Cl2NO5 — CID 42983001
[2-(3,4-dichlorophenyl)-2-oxoethyl] (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 42983001) has the molecular formula C20H15Cl2NO5 and a molecular weight of 420.25 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 42983001 |
| Molecular Formula | C20H15Cl2NO5 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)c2ccc(Cl)c(Cl)c2)ccc1OCC#N |
| InChI | InChI=1S/C20H15Cl2NO5/c1-26-19-10-13(2-6-18(19)27-9-8-23)3-7-20(25)28-12-17(24)14-4-5-15(21)16(22)11-14/h2-7,10-11H,9,12H2,1H3/b7-3+ |
| InChIKey | WMVMIISUEPQKLH-XVNBXDOJSA-N |
| XLogP | 4.34 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|