C25H28N2O6S — CID 42983212
[2-(N-acetyl-2-methoxyanilino)-1,3-thiazol-4-yl]methyl 4-butoxy-3-methoxybenzoate (PubChem CID 42983212) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is [2-(N-acetyl-2-methoxyanilino)-1,3-thiazol-4-yl]methyl 4-butoxy-3-methoxybenzoate.
| Compound Name | [2-(N-acetyl-2-methoxyanilino)-1,3-thiazol-4-yl]methyl 4-butoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 42983212 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | [2-(N-acetyl-2-methoxyanilino)-1,3-thiazol-4-yl]methyl 4-butoxy-3-methoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCc2csc(N(C(C)=O)c3ccccc3OC)n2)cc1OC |
| InChI | InChI=1S/C25H28N2O6S/c1-5-6-13-32-22-12-11-18(14-23(22)31-4)24(29)33-15-19-16-34-25(26-19)27(17(2)28)20-9-7-8-10-21(20)30-3/h7-12,14,16H,5-6,13,15H2,1-4H3 |
| InChIKey | KPZLCDHNQZVVLN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|