C37H45FN2O4 — CID 4298720
[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(furan-2-yl)methanone (PubChem CID 4298720) has the molecular formula C37H45FN2O4 and a molecular weight of 600.78 g/mol. Its IUPAC name is [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(furan-2-yl)methanone.
| Compound Name | [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 4298720 |
| Molecular Formula | C37H45FN2O4 |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(furan-2-yl)methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCN(c3ccc(F)cc3)CC2)c2ccc(cc2C(=O)c2ccco2)CC(O)CC1 |
| InChI | InChI=1S/C37H45FN2O4/c1-26-5-3-16-36(2)33(15-17-37(36,43)25-39-18-20-40(21-19-39)29-11-9-28(38)10-12-29)31-14-8-27(23-30(41)13-7-26)24-32(31)35(42)34-6-4-22-44-34/h4-6,8-12,14,22,24,30,33,41,43H,3,7,13,15-21,23,25H2,1-2H3 |
| InChIKey | NGCWYLHMOWLZQL-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|