C18H28N2O4 — CID 42988135
4-ethoxy-N-[1-(1-methoxypropan-2-ylamino)-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 42988135) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 4-ethoxy-N-[1-(1-methoxypropan-2-ylamino)-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-ethoxy-N-[1-(1-methoxypropan-2-ylamino)-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 42988135 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-ethoxy-N-[1-(1-methoxypropan-2-ylamino)-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(C(=O)NC(C)COC)C(C)C)cc1 |
| InChI | InChI=1S/C18H28N2O4/c1-6-24-15-9-7-14(8-10-15)17(21)20-16(12(2)3)18(22)19-13(4)11-23-5/h7-10,12-13,16H,6,11H2,1-5H3,(H,19,22)(H,20,21) |
| InChIKey | NNVLBYHCVCHGJR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |