C20H28N2O3 — CID 42988184
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-heptan-2-ylbenzamide (PubChem CID 42988184) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-heptan-2-ylbenzamide.
| Compound Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-heptan-2-ylbenzamide |
|---|---|
| PubChem CID | 42988184 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-heptan-2-ylbenzamide |
| SMILES | CCCCCC(C)NC(=O)c1ccc(OCc2c(C)noc2C)cc1 |
| InChI | InChI=1S/C20H28N2O3/c1-5-6-7-8-14(2)21-20(23)17-9-11-18(12-10-17)24-13-19-15(3)22-25-16(19)4/h9-12,14H,5-8,13H2,1-4H3,(H,21,23) |
| InChIKey | XWOPENWOGLQULR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|