C17H23N3O4 — CID 42988931
2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide (PubChem CID 42988931) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide.
| Compound Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 42988931 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]acetamide |
| SMILES | O=C(CN1C(=O)C2CC=CCC2C1=O)NCCCN1CCCC1=O |
| InChI | InChI=1S/C17H23N3O4/c21-14(18-8-4-10-19-9-3-7-15(19)22)11-20-16(23)12-5-1-2-6-13(12)17(20)24/h1-2,12-13H,3-11H2,(H,18,21) |
| InChIKey | ZHQDPRPZTJINNI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|